From 93d480d3efcc344304df13d5cd4bde6b9993baa4 Mon Sep 17 00:00:00 2001 From: Murtuza Saleh Date: Thu, 12 Mar 2020 18:20:53 +0530 Subject: [PATCH] [13.0][ADD] fieldservice_web_timeline_view --- .isort.cfg | 2 +- fieldservice_web_timeline_view/README.rst | 127 +++++ fieldservice_web_timeline_view/__init__.py | 3 + .../__manifest__.py | 19 + fieldservice_web_timeline_view/hooks.py | 14 + .../readme/CONFIGURE.rst | 24 + .../readme/CONTRIBUTORS.rst | 3 + .../readme/CREDITS.rst | 3 + .../readme/DESCRIPTION.rst | 1 + .../readme/ROADMAP.rst | 2 + .../static/description/icon.png | Bin 0 -> 17808 bytes .../static/description/index.html | 468 ++++++++++++++++++ .../static/src/js/fsm_gantt.js | 221 +++++++++ .../static/src/js/fsm_gantt_person_filter.js | 311 ++++++++++++ .../src/scss/fsm_gantt_person_filter.scss | 10 + .../src/xml/fsm_gantt_person_filter.xml | 28 ++ .../views/fsm_order.xml | 35 ++ .../views/fsm_team.xml | 7 + oca_dependencies.txt | 1 + 19 files changed, 1278 insertions(+), 1 deletion(-) create mode 100644 fieldservice_web_timeline_view/README.rst create mode 100644 fieldservice_web_timeline_view/__init__.py create mode 100644 fieldservice_web_timeline_view/__manifest__.py create mode 100644 fieldservice_web_timeline_view/hooks.py create mode 100644 fieldservice_web_timeline_view/readme/CONFIGURE.rst create mode 100644 fieldservice_web_timeline_view/readme/CONTRIBUTORS.rst create mode 100644 fieldservice_web_timeline_view/readme/CREDITS.rst create mode 100644 fieldservice_web_timeline_view/readme/DESCRIPTION.rst create mode 100644 fieldservice_web_timeline_view/readme/ROADMAP.rst create mode 100644 fieldservice_web_timeline_view/static/description/icon.png create mode 100644 fieldservice_web_timeline_view/static/description/index.html create mode 100644 fieldservice_web_timeline_view/static/src/js/fsm_gantt.js create mode 100644 fieldservice_web_timeline_view/static/src/js/fsm_gantt_person_filter.js create mode 100644 fieldservice_web_timeline_view/static/src/scss/fsm_gantt_person_filter.scss create mode 100644 fieldservice_web_timeline_view/static/src/xml/fsm_gantt_person_filter.xml create mode 100644 fieldservice_web_timeline_view/views/fsm_order.xml create mode 100644 fieldservice_web_timeline_view/views/fsm_team.xml create mode 100644 oca_dependencies.txt diff --git a/.isort.cfg b/.isort.cfg index 5751c40dd2..98b216f744 100644 --- a/.isort.cfg +++ b/.isort.cfg @@ -9,4 +9,4 @@ line_length=88 known_odoo=odoo known_odoo_addons=odoo.addons sections=FUTURE,STDLIB,THIRDPARTY,ODOO,ODOO_ADDONS,FIRSTPARTY,LOCALFOLDER -known_third_party= +known_third_party=setuptools diff --git a/fieldservice_web_timeline_view/README.rst b/fieldservice_web_timeline_view/README.rst new file mode 100644 index 0000000000..059c6856f4 --- /dev/null +++ b/fieldservice_web_timeline_view/README.rst @@ -0,0 +1,127 @@ +=============================== +Field Service Web Timeline View +=============================== + +.. !!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!! + !! This file is generated by oca-gen-addon-readme !! + !! changes will be overwritten. !! + !!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!! + +.. |badge1| image:: https://img.shields.io/badge/maturity-Beta-yellow.png + :target: https://odoo-community.org/page/development-status + :alt: Beta +.. |badge2| image:: https://img.shields.io/badge/licence-AGPL--3-blue.png + :target: http://www.gnu.org/licenses/agpl-3.0-standalone.html + :alt: License: AGPL-3 +.. |badge3| image:: https://img.shields.io/badge/github-OCA%2Ffield--service-lightgray.png?logo=github + :target: https://github.com/OCA/field-service/tree/13.0/fieldservice_web_timeline_view + :alt: OCA/field-service +.. |badge4| image:: https://img.shields.io/badge/weblate-Translate%20me-F47D42.png + :target: https://translation.odoo-community.org/projects/field-service-13-0/field-service-13-0-fieldservice_web_timeline_view + :alt: Translate me on Weblate +.. |badge5| image:: https://img.shields.io/badge/runbot-Try%20me-875A7B.png + :target: https://runbot.odoo-community.org/runbot/264/13.0 + :alt: Try me on Runbot + +|badge1| |badge2| |badge3| |badge4| |badge5| + +This module is the display timeline view of the Field Service application in Odoo. + +**Table of contents** + +.. contents:: + :local: + +Configuration +============= + +The Field Service Web Timeline View module can be used with minimal initial configuration. + +Order Stages +~~~~~~~~~~~~ + +The stage of an order is used to monitor its progress. Stages can be configured +based on your company's specific business needs. A basic set of order stages +comes pre-configured for use. + +#. Go to *Field Service > Configuration > Stages* +#. Create or edit a stage +#. Set the name for the stage. +#. Set the sequence order for the stage. +#. Select *Order* type to apply this stage to your orders. +#. Additonally, you can set a color for the stage. + +You need to add attribute mention below with the tag as base element. + +* colors (optional): it allows to set certain specific colors if the expressed + condition (JS syntax) is met. +* custom_color (optional): it allows to set custom color for fsm.stages + example custom_color = "true". And there is minor condition to follow to + implement this as. Define any one stage color condition like + colors="#ffffff:stage_id=='New';" + +Known issues / Roadmap +====================== + +The roadmap of the Field Service application is documented on +`Github `_. + +Bug Tracker +=========== + +Bugs are tracked on `GitHub Issues `_. +In case of trouble, please check there if your issue has already been reported. +If you spotted it first, help us smashing it by providing a detailed and welcomed +`feedback `_. + +Do not contact contributors directly about support or help with technical issues. + +Credits +======= + +Authors +~~~~~~~ + +* Open Source Integrators + +Contributors +~~~~~~~~~~~~ + +* Wolfgang Hall +* Maxime Chambreuil +* Serpent Consulting Services Pvt. Ltd. + +Other credits +~~~~~~~~~~~~~ + +The development of this module has been financially supported by: + +* Open Source Integrators + +Maintainers +~~~~~~~~~~~ + +This module is maintained by the OCA. + +.. image:: https://odoo-community.org/logo.png + :alt: Odoo Community Association + :target: https://odoo-community.org + +OCA, or the Odoo Community Association, is a nonprofit organization whose +mission is to support the collaborative development of Odoo features and +promote its widespread use. + +.. |maintainer-wolfhall| image:: https://github.com/wolfhall.png?size=40px + :target: https://github.com/wolfhall + :alt: wolfhall +.. |maintainer-max3903| image:: https://github.com/max3903.png?size=40px + :target: https://github.com/max3903 + :alt: max3903 + +Current `maintainers `__: + +|maintainer-wolfhall| |maintainer-max3903| + +This module is part of the `OCA/field-service `_ project on GitHub. + +You are welcome to contribute. To learn how please visit https://odoo-community.org/page/Contribute. diff --git a/fieldservice_web_timeline_view/__init__.py b/fieldservice_web_timeline_view/__init__.py new file mode 100644 index 0000000000..77e360b3a9 --- /dev/null +++ b/fieldservice_web_timeline_view/__init__.py @@ -0,0 +1,3 @@ +# License AGPL-3.0 or later (http://www.gnu.org/licenses/agpl). + +from .hooks import uninstall_hook diff --git a/fieldservice_web_timeline_view/__manifest__.py b/fieldservice_web_timeline_view/__manifest__.py new file mode 100644 index 0000000000..f1ccb259b6 --- /dev/null +++ b/fieldservice_web_timeline_view/__manifest__.py @@ -0,0 +1,19 @@ +# Copyright (C) 2020 Open Source Integrators +# License AGPL-3.0 or later (http://www.gnu.org/licenses/agpl). + +{ + "name": "Field Service Web Timeline View", + "summary": "This module is a display timeline view of the Field Service" + " order in Odoo.", + "version": "13.0.1.0.0", + "category": "Field Service", + "license": "AGPL-3", + "author": "Open Source Integrators, Odoo Community Association (OCA)", + "website": "https://github.com/OCA/field-service", + "depends": ["fieldservice", "web_timeline"], + "data": ["views/fsm_order.xml", "views/fsm_team.xml"], + "qweb": ["static/src/xml/*.xml"], + "development_status": "Beta", + "maintainers": ["wolfhall", "max3903"], + "uninstall_hook": "uninstall_hook", +} diff --git a/fieldservice_web_timeline_view/hooks.py b/fieldservice_web_timeline_view/hooks.py new file mode 100644 index 0000000000..d02edf650a --- /dev/null +++ b/fieldservice_web_timeline_view/hooks.py @@ -0,0 +1,14 @@ +# License AGPL-3.0 or later (http://www.gnu.org/licenses/agpl). + + +def uninstall_hook(cr, registry): + cr.execute( + "UPDATE ir_act_window " + "SET view_mode=replace(view_mode, ',timeline', '')" + "WHERE view_mode LIKE '%,timeline%';" + ) + cr.execute( + "UPDATE ir_act_window " + "SET view_mode=replace(view_mode, 'timeline,', '')" + "WHERE view_mode LIKE '%timeline,%';" + ) diff --git a/fieldservice_web_timeline_view/readme/CONFIGURE.rst b/fieldservice_web_timeline_view/readme/CONFIGURE.rst new file mode 100644 index 0000000000..521c2ebe41 --- /dev/null +++ b/fieldservice_web_timeline_view/readme/CONFIGURE.rst @@ -0,0 +1,24 @@ +The Field Service Web Timeline View module can be used with minimal initial configuration. + +Order Stages +~~~~~~~~~~~~ + +The stage of an order is used to monitor its progress. Stages can be configured +based on your company's specific business needs. A basic set of order stages +comes pre-configured for use. + +#. Go to *Field Service > Configuration > Stages* +#. Create or edit a stage +#. Set the name for the stage. +#. Set the sequence order for the stage. +#. Select *Order* type to apply this stage to your orders. +#. Additonally, you can set a color for the stage. + +You need to add attribute mention below with the tag as base element. + +* colors (optional): it allows to set certain specific colors if the expressed + condition (JS syntax) is met. +* custom_color (optional): it allows to set custom color for fsm.stages + example custom_color = "true". And there is minor condition to follow to + implement this as. Define any one stage color condition like + colors="#ffffff:stage_id=='New';" diff --git a/fieldservice_web_timeline_view/readme/CONTRIBUTORS.rst b/fieldservice_web_timeline_view/readme/CONTRIBUTORS.rst new file mode 100644 index 0000000000..dea63c0fc6 --- /dev/null +++ b/fieldservice_web_timeline_view/readme/CONTRIBUTORS.rst @@ -0,0 +1,3 @@ +* Wolfgang Hall +* Maxime Chambreuil +* Serpent Consulting Services Pvt. Ltd. diff --git a/fieldservice_web_timeline_view/readme/CREDITS.rst b/fieldservice_web_timeline_view/readme/CREDITS.rst new file mode 100644 index 0000000000..0eff0acf4e --- /dev/null +++ b/fieldservice_web_timeline_view/readme/CREDITS.rst @@ -0,0 +1,3 @@ +The development of this module has been financially supported by: + +* Open Source Integrators diff --git a/fieldservice_web_timeline_view/readme/DESCRIPTION.rst b/fieldservice_web_timeline_view/readme/DESCRIPTION.rst new file mode 100644 index 0000000000..b08cb398d8 --- /dev/null +++ b/fieldservice_web_timeline_view/readme/DESCRIPTION.rst @@ -0,0 +1 @@ +This module is the display timeline view of the Field Service application in Odoo. diff --git a/fieldservice_web_timeline_view/readme/ROADMAP.rst b/fieldservice_web_timeline_view/readme/ROADMAP.rst new file mode 100644 index 0000000000..f607015959 --- /dev/null +++ b/fieldservice_web_timeline_view/readme/ROADMAP.rst @@ -0,0 +1,2 @@ +The roadmap of the Field Service application is documented on +`Github `_. diff --git a/fieldservice_web_timeline_view/static/description/icon.png b/fieldservice_web_timeline_view/static/description/icon.png new file mode 100644 index 0000000000000000000000000000000000000000..955674d8f0b8c47de3ffa9db25cb109fbe4a1091 GIT binary patch literal 17808 zcmeHvc;{H3sucZElF-G)hC-+rdy@|cVP3o7ETY&& zJl-5>)T;P#Y>Z2k74p9gK&J2CJC5%@{WsV@`$(=#w|Cf>44L@opuIqTY_XMpYif9< zJEhZ)*(Ciawd2E4g!g{`tf-6DV*W@FZ!b&?uih_mMpBM%8|x61r3D=Pkjl)*LT52YNq;hIj5|udFA)RjvAIV zR;k3*$i5qSsi6bcd50k9_J$d6qZe5$CLIT#a*i*=wkVz%dgiqH(oe=68=3m>aXb03 zuyMGqBG(dcQxAcfP+K4yg1i{GtF9VUM32?R>d%HqF@xRPyIc?3mifg(5sPQ&5bDFm zimOQwOnX4K!Srd#7sF2xi^4^1yiGAIq~p7mmzr<~Lo z`^Zj#UvWcW93Rm$F}uR@r0rcd-HSU5-(-GqWovBbB`xhmjl4J(??0#Kk62I~XSft|EnXSitq|ZL3=o#1EvQgW9 zJ|12;ejG8^^|hTqjb_(={4bNTpQWY8O}Sq_{M)O6b6uy9w|sdo6^zbBeKnQ6ZrBxf z{=<=LGexYoQ+%!%@poCfC;cW~ny!1tUwf@o9+XcXuz3-vA`{X*t(iu(J(v4eK3$BR z#?wsdnI9niHT%fq-!r>21r=>B+y?CU48s?sGY##Qf?l6kS}{XEKaG3P%=c#V{Z`MeV8Rg#4Z(I6 zeUkKcouTFhVv!mqpgP%TpU}z8*Yf=tv1Q~b#DPLwkmDjH6U{+_F!pgNVV@}v zE_;Oc;S_mM$!3hz@uxyNzlJV`D!(V$L`Z$=*YjiSe_v$^V+Z*0H4ecz-X^KG3Xh91 zJtlf|UNz07Y#FKl46c-J6y0GhCP<)$*JggiUF@eIv9sen?MtXFOuac$_`IKZ&l|z) z$DT>fB2eQzolI1)xny!__wV%Nr%CM35kW0htameEa2Xxl-VJUt0m|nu2U3$ze(Tv8 z_hVB{JXq83`D;Upw=LOuDRooALyP@8w;=UBLcBPO_Oo2Eqzyr^s9lFgZ;gA+g>qXL zQ&>MXjs}PweSxbdKlG#^m{z z4MEp>mrQoM81`rGl4fG*YlUD7lD(ODkJuzt4j+8OD@_^c{M?VWMvL-mhf5~AL_6K|~@F^Eh5X5Bh|N|tZb>4SGD2C!(~DsSL~^_)(2+Whr4`XyCSV{(`B^kJm~Sq5H4 z={4Mo>%Pqe9hXx1H!&Weh$$`>=k4s~l1y2@kbRf3#Hj62w#Y5v*j#41aOZbPZKJoD zT65i*>hQ5H;E&)$J)> zuxv=r!DD1$E7*+}4Znaljjhl{m+jeAD`FwHnWb{?rNRS*#3~Eb#Z1J*x%}A?y#QqE zY3J9H`r#V7#3BN9WEBUyms973^%E}-Q85dO6vPw{YyP8Ab4h)?4d>@Xa#ek}@me&_ zsu*@8-MJp@l{Fajl%X)8YIcH{gQoNo%j$Ln89tr-rRpk=Lq@6>FU_I#jZ|+7ZKE>6 z`W`W+WV)WGFH2S=CjUICcO}vmZk_yD>>7iGl&wC-+*cwN($J)jR>5uzBwO^18T3HJ zT8ptb-yH>B@o#OOS75y{VrE?xxSu@8N>}~U{LqHoaKE;reTWfe$#5$VNM4#Fa zZfkbN3W0lG%wM)^|%PIa;|pL*eGhj125^^V^CQRr+V=S<3oHC@VQ*Rvr%;;2?TUnpig5 zs`9&vGhHwPd|19TpB=*Cu_T2BC$2Fz*pU2+51AZVxI5b)^K-JSFG}8$HTeA8+{C9G z*4RK}Arvx*HHlneHX#xcWra;;X7HN0S|>@v+IX*doQvK2OR0MB!&KBFV8_8TA0ThE zUCUNO#Of)<)vmp~sOy>|@lwf~eO7X}(3(rQI5f_v+RezW-U2vuDQncBGD zF(VA7*oS6JB(F=kHQ%l@G%-$VFA?@NnvM#;BzN!R{H%%y6~sEZ0pg(3FEUZEuc7No z1Vj|DQSR`iJZVT3MW?4vwx^xq7#`xvF@!X|rJ=jmC-Mdo(DWonw&V~O<5O8-Hkh zOEdL3#D24!;Y?zY9P8c(<+YD8#kyPIzaKvmD8e2y)X6<-*L!drI*zBDi-i=0uu5G` z$J^EToaG?!T8-pJb2(>-C$@OY{R-{yWp zii!?Pz`{sZ2%!VEB+y#c+Vk$iN>j5Wy>hoJ+R5)5Q+5@NKuMolyQFK^9jgWXKvtad zvnR{)_U4xGO`mULUP(d`1_ugr8!tEcJ4M87LxLFW#JOsVI3d(sq^&;R^5av?A}=9E z*@zzYGj@5w{;!VC2hN(VF{>|nbd$l!@6OZSfDI?==C0&@N@ob6!tY0y1(_*y&gn2n z7{TwW-TxBjC#f}hDQ3*~wR0UU=GR0P(iD8-Ess&BusECJJg1h~m7+-(T6nE!|L#W% z0cxy)EHM~T8h=1~aH=vJa5OPQW}I%FT(w*L>->d`ohE-q_uu6`d&$=gznwiw2sHISjYlQg zJdPT=Lce8FTqkR#p>6iek2&+loxZ8D=317tg0adE`KvP@dEz~z&(^PXsw-I*i|n7Z zjBn=~pL05}RzkjtUYGiDjjYe|d{}5ng8KHs*Q&#|#7BX0P0ol_&sQ9+?c)f-r7|V9 zW{d0er92o2iOjV{2m4bHDq)~+VGPX8r!wn~Tw-Cuyh-+}a=4t*5DQ!vMQHo5_>#U~ zdH14?&zDw9?WN;_v9T#GGZDMWtHmcL_-T#FMP=k>C4g55CUZ9uJWD=ZrBlCtNAF9l z@}wNeXq{=>N|JW<-=9^%NZq@qD`^8Jx&@Q}FOt)tNn+diSNi`K_DL$Nnvt zu(FV$dO0oS=wO72Q}pS4OQWZ-#VMc6GF73?o_c#@gQ8z9N@85$;+n*+=~M=uiB~wO zIx^Cwjz(`e0Ep&p^s97SwLh5b1bwOQrg^`bIhW>X(PiUlqajhz$Lq%AqqXXcR3w>U zQ?V_Z#z3F}L=jbcQH|n_%5(orK+U`JnwB2#Gj)=6&QF~22uO`_`9jJyyJ8H zR4MQj0#zvrM_G*LfnE$4dvKY5;+{@!^uVaBx0sW5R(Va{fjDg2b+-X!Rpl85^bWB# zL9CiD+sGE=o-65iW$h4uxUXg&h`T0!nGZIKie9}ry&|9H(r;q&I=fR^3+ey~x?PS* zLU!r0Qz)^?QU7_&Z-wEqx~;huBz4DT;n zx%-9VM*R(Lax`-HjE3yUt4@Wat&nK>PaVFx2bQR$UWup>vT?^t74*Kd-RCxZCP7w5 zCn@3jHF~7O(i+{3BlWMeGjpVF{jqkhW)W!pqhO+AqXEH;KmMn=t2!mb{Kh_I7M5q8~NAl_$ji!)jq4t6m`*jW6}ei+TZ`>JVA2k2RR}e6S}3qpyWK|01)a zR3y2>nLBJ8_^@CPxBg)yK6-VoT@xW*C0*>_*L`eAVyYOr5A3KFNm^dqw(I?-Yw6L@ zoy~;Qb3~p(uU?YV3mE!-rzULw72^J;=p?v5n=|iyL+@c1sj!eEfwjtg`6QG_ga_BU zJa6*UhqUAxgCJ#B#nDGMS-Ps5ajoD%y3@2%#z)He1y8=VS)3$oKSg@O7(B&}zX%u8 z9P1g*YG$C;AyMmh7eHKDHOcS~kvtWsU`bu}b&mw-!cE5K?x(GM>=RxM4T8vfAmN{@ zL=5)7Ss1S(H@%!1HdUYJ26efRKr8#p->jZjuY6)xtJM4=gT=YOl?gdc*+S2T({1LO z2I@rMKK}-_4fg~L-n0^-+PJqs*IOF*#$5NLl0fo7ezq>c!1G20)wsID+*dwjLR7t} zy^R(o0A~PApD`${GLOv9nVW-OKz&oqty1VXMng_1%xLePEL(2d_bEG> z_E*2rzx(>HZYnry0S}QT6&32>eCxk-5+#J29`9Y_{%5~k$S12G4A&%7NzX0M_P*nIkvB0&E!5Gg zGtLt;c4XwqqRX&R#|B~Oq8IN8yti5yOd-lDP#MFTUtsf__`)d0RUI{p$0S)%|MQ)E ziRf>W+vVFgbIDXxmgqO5wB@bZ=_@z4aey&sTy~n^_c+OelD5;-0xF}iTuB!UG$->A zYNBiHbFc2*#?PSLZOfW!Nep#bUVVFQ=KBbF&=f^7f2^cHI-a}DpQGKBPo_}s!>d{? zd*UX$2qC|#1)qJFYc&lehUmL1k5ix~s~Nw_4Y>EdA$dGMRr1kZzlFSn&=EeO))69T zz8SXDw#af^8_$tX%}#4Ox!ZOK8AtDW(p{zrSA5q`Tu@(Jrg~6TO(mlD4b8XpLz}%H zyp7CvE;gNcHWHs2^y4$WAw%t%GcafUgiH=@HD>~O0?B{KwQa*=MVb@;b zEYNwm%dnOVyT;rL(K48AR0^=9t>fQZQxUB!Lu(T>wXg3dECL_%22JF);t$<89Fh~T zdyVEF%4gK68xv312&aC6r7x&{@zl85Euq?xiZlAr4_Ms~Y)(zf{Mv$BX)_ILA^Aj~j;my-Ox|Hu|O6dWimSNEO2i(%9Oyn^kV;#= zJa>%=k0D$V(xnl3-IIqcQnmA@q>l-hD#Oz$1w&P+C8T^&M(1~tz9BF~!l9ej-uD2@ zR9@|0Q`+a|W#j+DfIz*)Kp5TCE#swLD;1W#ik2QvYT0bFa%+bL0IXVPOMdN~*1LgT z!mb3hM&79NZOPv6K6{A;g=)$Aua>uTx_T^MEmpSVPM_b=Kx3mR8BiHO@VLelzSq02 zc0U-ax*hWjmaUtz(x60_n(EiollZ)fKU6kiwCH@^azWhIyZ?Qe|L2D;W$GoK`72#N z#Az9QXrtcgEC;7BwPh<5*O@92C(HSj=mO@w?L*lH%!x~k?NyrUK76ut-NPZm&Y9dv znM85NnCw7P*&(;23EXV_s1QhaYD??ycu|*bwtWUhu6e-w_;LK4xt8x*b@Hf%Z5w3U z#KWAtsg&Za94KLq-mSkqLlM4vEPSg+Bv}on47spJJw-87`ImL>5jbBcWTj zz0!b#Af-7fi37khDD7VyfZbV!7Y=pF3-KD}!Y@+a4rPIWQ({X+NxZ*phei2EZvm)T zw-Y45CIbjv+_perJBcM!;kv^3V>X@JgI4(E=b&xl?U4eXogcT+RLp;7rM;T|1`tl_&*=zD}8mBjFrGM&H(zV#c4_fC+psUP3p9(5>tdp zV*GfGf9?I7+5G1D{ELe>G1#`(-o4#hJWlz_-+R|G!XKD{!jOJq^de0mrrq%s)K(-e`F@4nuS*U#R#zvJR@!Cn*N!)Fwe}bW~MiuSGV;jvD@i*rzUxLPNq?I@Y}ho` z7hkg(>BOuWN8_!7JrTcNF^-E(0}=X8 z{NX>#aj;imRy4Z)_swn{M`+rA?$?ZXqp+YbuC7U;v*$hV9KjPAF<@?c6-uCWV#^C#89W*Cmt(to_}}v5>(+mM`@v3ob6v~tnOj?H_0|K1 zTB$@ZhhmOViRj#b?-^4b6-maplLGGCGYWe3y;B1L2wp`HwOfC^VHx{aqx1UqyPzPQ ziKXLJUe9D8Hfwx)$L6rezuo%3gg`Ow;t#%=c@d7C$U6EPdCyF5;+uyKf2BrwEVKdI z#GnFVq~o6QNES|F&q{;z5vYq3_XN;_wC=|wms-~CL5H?{cTgMaKWmLYqsk-@E$eE5 z5OJyrt8I=pn8go7$<+dg*XvKJ_UEh7G8z1;ZM=cz?ixHC)2z%j_Vpo(1Rgj_Kp0Zn zJD_jWRKJM+)KsdT*0mF*%|Xs3CwS^&oBciALzjS0=n$|ucrKYj>l&22xJUV2S0h@HomV;ImUK$Y=qaQ>k^)^cdIt zIq-QQx&|NhRSfA#Ouk$L5IO=1*In25Eeb)`A?11>OrSyT{h~M!!ob}1yoq9?2!{l{ zt`wGxPlT*?+^Om6-eDYcR)=vZDyLP-JO_$H6mnvX{f{!^pFE*;z6Io9q1BGZ{5HF! zL%>ZNEqY!M56{NK=Ku_bl2rf>^okfO4LEb1_rA#tG~ys)R+q-uRtz5-JSzQ{umxPibOH+T*O_)mAWnDZf5DfEOAgyf?Tg=1b_Tp z>zpJHFM>Y0yP=Lt*AGgfUa2ash zd_wcdw{5@*em~rBjhSSJ*gG63@fmbSWI_YDgoGPntbpgD>bUY=w)wjn?s|<#CB^^h zR)V-v{}OTzmPOE(1JHN=_cojaFsr167|5(0QsYY~7e{)YZAX;zq*t=~uGk&_b}LhwbP+ z5NQwxc7d`aW{lpS3E{+g*c@e!c7NJW{~1$c)!MF!zf}%KM6FJ{_K#d z0hCc@dyc`9rf=E~azy={W;Jwc!9qhw%J)szPwNf2u3$A~a4_+mE;&|-$iZ8ky*q-Zb`)ix z{A>ui(@syZ`@UI0Rk_X9fKps=chNU<=SHBiPhD)_a?g(c0Zc8K0J1RpB*61r?^I=! zp|X`XQC0jqq3E}wpKLJwEIg?VNO6Ed7jADGUHkM(dK8dG_d`at5eO3)7C=oA!7(I^wu>rGbT}M^#%j1GBcXT!NQ-p_A7J#bUwK^tXFNI?z2g^?~{AFr?ocuZ7CQxX7bF z9K{O!{^^cygL%a2@rr!pp~6o~XWwkbrI^xA8C zRGD^2)(4TKKXP{ZzI3&6kBAZ^Xod%uFD%7;H8t<~I;@sFxQSS73ngYfYJfruwt6_E z0MLfLqv_0vHQonSjqD}K$^t=Y|F`S;a#BoO$ZDJ}%iEXnU*BT`SVJI)16gEE%Jc@f zOHkaW4=M$tZcyvY*bY*MFEYx)!g*isS**JJ%=y!Yt8`aC?e1Ha=t8>S5|2gqS-V>m z!Ots<0C7RcI^e!G?O9~qIm`ZcCKWcZR*ylKKz#m4-OT(g(EZTB4!Q(LY~p;Z)}y;_ zff5oiNcNuj`AI@faP?5CqPCK7m{R0y&bC!V-Q?RtF^X`Xt!ANv*(V{dH)Zo$poqZb zpoGc29t2JFYejEt`PnG(ST|sOH&0u94Xy?w_>$jK2D~TDHoliT*R>gyYh*iDnp8AA zU+ugn@-$KuHsqg=tyZb`inuc0&(Fl{ZNA78ng1wHU*&fbDomy9a!JpulJXafNc?ecuJ0k+TE|~GSM#o0CmLksxPORgG~n_vW`(5qH}COjNqk;` z@P!fz_xo|Ihd<=!-1tdUCQ(lj{Sq4Isn+NY_6D@U1=0LFY8auZfZQps$bkGCggWcwMkwqqpj3K zO!r^z0A8u=!@C{>TMJyr$xg0|n-6T(zp7LCWAzd|z*h?MH1*o4iw}=1qE1TXPaqx~ z9atwR9eom7*p+Tj%^!?#zx%za=fK_+f`9GR>q%J-#;tsoOq~{L%H$hbD)G zHNG0gUFb_n?7$;f>3z2Al#>hzU*C-qpVkIx@LP0oywK6ieJDmelNlf?=bb}IYNEYk z9;i8iYW%$Mx1&}FcUczm^vt>3`OMev0$5p~41pr4>PzVlmuFugh=~ekmi4*CpG}t4 zQTd%K94ry_(_(M!uYzfu*KQtT4)hy*0G&>ToVNvtgbgwc=oonMWnU?e%(5*o69jUJ zeXoGKk+E9=LN+2&g1t*@Qcn;(XK?fG+WilgDS!4;W)if9i_;1-aG&d!b0$-RH3zjY zzG`0J(A@~)m@Wtv;9L)!BcOaY0s*${6bU3`MIb0ZpPTxVs2J$GVi6xU>HQDYjZ!}) ztC!w~y*Vrl|>V7#! zFJ+7&8keD629@lrj_sWccA*iZp=bC#$`iLJIgRulcR_9iv_W6Rf3pd(uOQD@J*f;) zl)lgS`4zEhw%|WK1PRM@(cq0JfBM~S_F&hN>D}||KpP|+Pc`%NuT2KBRiJP|$eEe? zN&g?AN?nzj`)0W8Q%z6=rF!u_64|Z~1|b+F!Wc%qu%x#` zw(+vW-k-`kzr$rm&(773j^B;>G*5O;C!3h~fxHbw0+fL>0UBz4 z*T?Uo@+^Y+C5LGYEXr7XK{moo1Kzj$YpxAXTtLdP+lj$|BnN)2syUljdwg6Q0maMo z@t)t2aM=PvKJonG)H7D6oYw3~dD#zBCN(Vk=Z?IVJ)hiziei1E+-?Yjd*TA@fEagZ zOh7r($IT8mBgQ6q;PzTk^3E5}R7`Dm)$qWLx zIAdZF2y8H5RK+j+5=NR!rV7e@zd!qqo=<7hyh+%AI*HK}9x<`mS^LAE8yQPF#Gt!$ zLB2pS<6RO}eTa16e0_l-h~5(?XLZ}|Yutso>Isy5@WuCSV@z5d=A^SEU8K{%>`iKnd5oMAR*z>WgkTpU1i6AaG4#KfB5%xuHh>Hfe?ke zMyYY^E4(uvUPh=L`tWx`v6`MB)AwA@cZOX)bvc@@MbzIsdIr?ZD5#?X0bjr-8FG8a z{@_O1X$bWeo_(E7tAT*jIhZ-MMmHDJy`-roRBR_bB8{_w^2_wTvaSir9!<&9)C|@% zh(5G|J1zdM!(WJ;Ba8!{?wHF&N(gIzcP?TMiFk*(L6Iz$<+CHNIF3S(FealbK4l{i zHlbS#fZAALjc(g~K6Ape(|FLXc~daz9u)K?i$2g)2jE%}y1&%6UsVWkGL6{q{XG{) z!87>`wAQjkABSid;pS~GVzTAI(|Gm9U{Lev0AIkRD02Upt+D{{Qc0is%F}j=PaqNI zZC<6OOUe1WgM+DrYfHLP?Drsadqm{u8*)_^%|9fZ?beKNI$U0>k(5NU^@IFiYODfm ztTr>K>=g5m79e6vy_z41-uoA08g^4sXA(GOkeh=k0WN+{y6uiV5{gV;)p^GNQfR}^ zN5O-)a+9^OE!9j`a#$L*qr^^N zHGx9q^ds-5zku?^P!_gL{w7d$9nket!lq_M@uKtd=D%*Vc+65BFR0xlNySC-4;U*^ zyu7QEI9gu$Ss#{l{7MC7;vz7$zRTl%|40uV4;ZIjBGb$|2PGh;L555}5U+$_&h<%x zIW)<<(7><6t@HFP_aarR_Mr&ce}f-jI42%L5_nk-_}#^lJAD~_Ie*^ySAz?F z(bY-Y+*LV$`)YNjzJx6u<`b|o0{N0VP#)m2+lC<16j|{sRtz8&wpTAGHEHbETIMwPM5s^CgH7O-Yn@@gb(pLio-EF8EpAm3<-P*Px3^Lj{AsJH|` zDl}_ExPeB6Y7d<6c&vy#RgT^H4Bf8y!_gTmTC+K)V+m<(ytfI zroj4o+EK~BcN>9Hj{@#^ff~cFh)Bzy;qZAGU`_~f-EJa|FGxe61E*$ANZau6Du_z9 zt&56mXcrY)|IhBq{8HlQghUl@L|p@WnR)jJD}sw{$22ofd8?m>0DAHuGuSa1j$Q&C zD-HU>9JRl_{-<0!SIeynAotW^Q`h9TQ9b6Y@0;Eszr5SJ^p+v#UZ1I@v}$R zrB+npul%N(2EvKFwrD>T$iVGG@1?E#{XV(?7AcRG6Cjwk$q41dbvx?$f?xJ$!6%r$ zs(tMkH-zO7D?E$p*UjX-HJdwxs#ho>u4v^;Ly~`06`Bt1Y10`iB1a@qAUMG8kK3*Z zH2p%Etqx_i*p5rjY&wDJ6>7Le0veqBZUet``@r82;^0)gKedUbd;B1?f~r0pOizz=Sue^P#>^nqnsOT9+oqw#Z>;P}m`%w63sZJ$sJzN)=e4WzJMl!N`mO|R`!?W0Y|AJb8=p>KkNMi?XTL_h{O|as! zhsCMLS$u75XOaQ28^qr?Tx8%P)7``59~v6a zRRmq-&k_Q=dYhJL_YjnJz!1)+lZZZo+8taAwra{j$!I8Kxq?lfdO3iqXtOtPl@*iC zFO>%T*6l7{i}+}W2I9!zfhqxd%Fso{6oWykVgKJe!I?bSHc%xL!|`VVMID6pu2FgrSs zF5Zm>Xpt2Ug=3j_nl+C~g(SXS7}Q_j9*Q8dTV*^FXeZ9o7o5I!e&i`K?FecTG@@mD zkF=r_?LPftpeV&0H(S*q6xcR8blcwzqy%aO2eOHVu|9rem{P~H&p~MA-CGyDeVFoR- z3w$_BQBg0GB8h<~MOr+x{6VV+k-4tx@1e}pl}zlrvY18zD2;4IvfHvDLcFSz#CHg_ zHI4HS`$m4*K@giN5v2z1)Tn~0`@oIk6)I10Eq7rh0ImC`qx+!P;o64#!Jy>DEAQW) zPF_ubMDQWE_QndwN|Rhte98{tKs_{il~m)_(_9PxeVJ)o(%y~mRYN~EQb2=Eb(jAi zUUJYla0vi^5Dz|5A4j03*8`gmCbG!;SqM;$Tp5D=yoG6ugR&;EHZ;wzre83X55Bu7 zb@w2u)HJh!pUcEv;=jW6%rpUI|)aY)7#WCpnDt zHz56?xeRn_C1L(GW?D;Z1k!)QYgkO^9f6L4vzBn>`c2H!d;Kend?DGSU|pxfF-Nq= zxB^bL1;Spv9n?@`afiRq1XEFjAg_htD`ts;dZBrahph#h)8-OO`T1I(R#1u@dbQS1GdVCW( z(TEq_JGjUdQY@l$KnjevzqJEgMn9oLqN0FHBOuj0BzwpS(1^*EecK~269RBW9-K)$hfQT0u`)3UU=|L6)a$@85~9I48v;3{oG-f& z;AGrTz1Gnf3#oU7-}D%-vI0Pb;39lj0Wg(C3~TiR&$Mr~Vm&b&tD+*hHf;QK8Yug7 zV-zUf1P-1?2N(H9k!4p@jSCndt$r~@=lksQtWUJbva(>Yhk?-B_&Ssy%iZAp664ST zEvxoZZtO_x;<-lb-uOuwR_$LB(0CuKFW9A$6py~IVJ*w83S+^=s%sLl*&PNBhf^tXepT1KL^lYWb7isxxa6)zK#c^pwyWaACqF z*M=@&?-yF3$Gg7$)$P2H{G6vf@rq$zTW4U~+w}$&U!k@P>8n)0P2f5?zdX8;S3L6m;(he=iO2n!xEb2?+ z@!Q-vFOf7o*bb25t}J;Bp4R@;S%M(@z=NWllIRf?>n`)H*0Z?m#3*ky7tppIrQOKQ4h1kHTSOsIndWhMzDgQw* zjVMFQTwyXs!lbb-eqjNQB071^_^EGui-jQ;@8f^mMVmCA=Fga@CbN_{9c;}}=t0s% z8zQSSTWt+A*Hw`E_M&1X(4%{FV}CmD?9@$;u@S==IJ9hhh)NURRCzp1fZCLmJ^M7e zh72){_{dgn%}`D!u13?N8PUxoZsA6cU|7~%t}~k*AE*L_Ad1U=4x$i1Lo`0sPuCvu z^5AG@ObyrZ!kLuW)5*5oOiPz#At-MzxmnXEToM}$KrAjwQy~|a23I#P9j1+@xzk{^ zfhLAvD2T^d3029YFise#a#6*3)B-^mmKPpN+kHJwT%AI2*`K5BVL;lnmo$6^@@U=f zc+ISm{@BYikpU9^g%cXhJgmbZR0K|L+Se(zAFutXd2yJSO_Try$CZDyF+~VzdM~k& zuy{`=LpyKZ7rU-xUzDfFAQ;>M+y_j#&eviD5tA_tQq4HZE%v5MoCXLwB}+C4jK0=Yy|(o;xV_Pyf~*E$*B-T=wsd(tHd}>b-UDg&>oS2 zl|{JKU<9S5H!6yf?|?>#6i9WJU7s1DhO7yv3bnOtqjC)oApuf? zRDq~vmXs)!^)DAxle|TROpLUP3-exL$jN#3TQ+5Qb6%Vp=u@fOJIik!9AQQ+q)r~h z%EiGEUUglrlu7`7E-UfR0Jzi%y;Mod_>;1CEf2h-2_4>Ba|^9@SLmgK)4A|h@`n$y z^RC}_rl?OYF8H+V!okA>{eN&a6c3SlQkJeizKbAuoap~AfZdkj$wV=5W)TK)VyHnH zfI?_uM5Gc?LzTJW>(aQRBgTknt?V zl4NBQ|Ja#wJo%iNHzqeud2-LZ;5dz3sg&%=A0N<>&eQchJsGLf=^SFvU9HfcY#Ud| zgSyJ0D{|rj`Us)=Oqv|Dg`)oYe@o|1j}FMiHs8lsL9rdyo(w(yZ%S%dzL%DAKN|+} z9(_^`2D%ml(K|UWU%sqiSpAHPxB$=vf@EuoC~l#JJ}~40%m2>j zGWwXHJI2OAP%xvDU9Fj)f3zvya2lRc-*b24QTTj4YW{ZA8xplo{PTs)6LjtvE4+oq zO>t&E^fTM;A=cV%8JzPn3PB&kAXl2KhW?Nd85wzJlx#0ijShXJW?6qNFT5WHgX*`4 znAw6(otBnuX*CHI7J32YAFrpeFe*%n?tiX`q=R&agxqy8y^(5Q$_ZB`XM!tI*GZbX z(X#_0LZp6h^6*3~mEHhT0b`4Yup6AXVlpn+Q7tknyZpxvuEohyH{$F=!8mZnEQAjI zQ46(s-Yaz;wNUgv&W5ThKB{W3(9dUm{iObJMRL?`A=vQt%jg)l{#&O4GI+#Kwjew0nySosF+@T>xBYngWHD;bxF;7b-%>cT74(~!j za)0gM!|>0eyS75X+B()YfAk)l$Phu_s10UQ8K<;`o;##M&SgtTuC$&4T{~TLYh~dK zLm$LxbZ^z;{Wl*6GW5?iFeeetYLG-nRdM6TR)K?1<#+hD&;m{|(ME|BrHBci#pV0oF(@prIFR=LEDdC|` z$6e@>ZBk~p1x{c}1ap=W1^2W?Z=AMy=;mO76+#5-nyl4XmK<5P7YCL|M_(NIF>`>^ z*RLK*lO8nwDMbFyjM$-Z6Jc-2q&bOb^^g1dhQG`X-*=g!K5kpSk08tH`uba$AEu(3 gUHh>HCdQ7*k1fAW1vhU(MTsEtw^U^Fq)ngxAO8EYHUIzs literal 0 HcmV?d00001 diff --git a/fieldservice_web_timeline_view/static/description/index.html b/fieldservice_web_timeline_view/static/description/index.html new file mode 100644 index 0000000000..59942d5588 --- /dev/null +++ b/fieldservice_web_timeline_view/static/description/index.html @@ -0,0 +1,468 @@ + + + + + + +Field Service Web Timeline View + + + +
+

Field Service Web Timeline View

+ + +

Beta License: AGPL-3 OCA/field-service Translate me on Weblate Try me on Runbot

+

This module is the display timeline view of the Field Service application in Odoo.

+

Table of contents

+ +
+

Configuration

+

The Field Service Web Timeline View module can be used with minimal initial configuration.

+
+

Order Stages

+

The stage of an order is used to monitor its progress. Stages can be configured +based on your company’s specific business needs. A basic set of order stages +comes pre-configured for use.

+
    +
  1. Go to Field Service > Configuration > Stages
    2. +
  2. Create or edit a stage
    3. +
  3. Set the name for the stage.
    4. +
  4. Set the sequence order for the stage.
    5. +
  5. Select Order type to apply this stage to your orders.
    6. +
  6. Additonally, you can set a color for the stage.
    7. +
+

You need to add attribute mention below with the tag <timeline> as base element.

+
    +
  • colors (optional): it allows to set certain specific colors if the expressed +condition (JS syntax) is met.
    • +
  • custom_color (optional): it allows to set custom color for fsm.stages +example custom_color = “true”. And there is minor condition to follow to +implement this as. Define any one stage color condition like +colors=”#ffffff:stage_id==’New’;”
    • +
+
+
+
+

Known issues / Roadmap

+

The roadmap of the Field Service application is documented on +Github.

+
+
+

Bug Tracker

+

Bugs are tracked on GitHub Issues. +In case of trouble, please check there if your issue has already been reported. +If you spotted it first, help us smashing it by providing a detailed and welcomed +feedback.

+

Do not contact contributors directly about support or help with technical issues.

+
+
+

Credits

+
+

Authors

+
    +
  • Open Source Integrators
    • +
+
+
+

Contributors

+ +
+
+

Other credits

+

The development of this module has been financially supported by:

+ +
+
+

Maintainers

+

This module is maintained by the OCA.

+Odoo Community Association +

OCA, or the Odoo Community Association, is a nonprofit organization whose +mission is to support the collaborative development of Odoo features and +promote its widespread use.

+

Current maintainers:

+

wolfhall max3903

+

This module is part of the OCA/field-service project on GitHub.

+

You are welcome to contribute. To learn how please visit https://odoo-community.org/page/Contribute.

+
+
+
+ + diff --git a/fieldservice_web_timeline_view/static/src/js/fsm_gantt.js b/fieldservice_web_timeline_view/static/src/js/fsm_gantt.js new file mode 100644 index 0000000000..dd0aa0d928 --- /dev/null +++ b/fieldservice_web_timeline_view/static/src/js/fsm_gantt.js @@ -0,0 +1,221 @@ +odoo.define('fieldservice_web_timeline_view.fsm_gantt', function (require) { + 'use strict'; + + var core = require('web.core'); + var time = require('web.time'); + var session = require('web.session'); + var TimelineRenderer = require('web_timeline.TimelineRenderer'); + var _t = core._t; + + TimelineRenderer.include({ + + /** + * Init Overrite + * Parameters: + * @param {Object} parent + * @param {Object} state + * @param {Array} params + */ + init : function (parent, state, params) { + var self = this; + this._super.apply(this, arguments); + this.modelName = params.model; + this.mode = params.mode; + this.options = params.options; + this.permissions = params.permissions; + this.timeline = params.timeline; + this.date_start = params.date_start; + this.date_stop = params.date_stop; + this.date_delay = params.date_delay; + this.colors = params.colors; + this.fieldNames = params.fieldNames; + this.dependency_arrow = params.dependency_arrow; + this.view = params.view; + this.modelClass = this.view.model; + self.res_users = []; + self.res_users_ids = []; + + // Find their matches + this._rpc({ + model: 'fsm.person', + method: 'get_person_information', + args: [[session.uid], {}], + }).then(function (result) { + self.res_users.push(result); + for (var r in result) { + self.res_users_ids.push(result[r].id); + } + }); + // Find custom color if mentioned + if (params.arch.attrs.custom_color === "true") { + this._rpc({ + model: 'fsm.stage', + method: 'get_color_information', + args: [[]], + }).then(function (result) { + self.colors = result; + }); + } + }, + + /** + * On data loaded 2 + * Parameters: + * @param {Array} events + * @param {Array} group_bys + * @param {Object} adjust_window + */ + on_data_loaded_2 : function (events, group_bys, adjust_window) { + var self = this; + // Make the user filter clear + self.$el.find( + '#user_filer .o_searchview_extended_prop_field').val(''); + self.$el.find( + '#user_filer .o_searchview_extended_prop_field').change(); + self.$el.find( + '#user_filer .o_searchview_extended_prop_field').val( + 'category_id'); + self.$el.find( + '#user_filer .o_searchview_extended_prop_field').change(); + // Make the user filter clear + var data = []; + var groups = []; + this.grouped_by = group_bys; + _.each(events, function (event) { + if (event[self.date_start]) { + data.push(self.event_data_transform(event)); + } + }); + groups = self.split_groups(events, group_bys); + if (group_bys[0] === 'person_id') { + var groups_user_ids = []; + for (var g in groups) { + groups_user_ids.push(groups[g].id); + } + // Find their matches + self._rpc({ + model: 'fsm.person', + method: 'get_person_information', + args: [[session.uid], {}], + }).then(function (result) { + self.res_users.push(result); + for (var r in result) { + self.res_users_ids.push(result[r].id); + } + for (var u in self.res_users_ids) { + if (!(self.res_users_ids[u] in groups_user_ids) || + self.res_users_ids[u] !== -1) { + + // Get User Name + var user_name = '-'; + for (var n in self.res_users[0]) { + if (self.res_users[0][n].id === + self.res_users_ids[u]) { + user_name = self.res_users[0][n].name; + } + } + var is_available = false; + for (var i in groups) { + if (groups[i].id === self.res_users_ids[u]) { + is_available = true; + } + } + if (!is_available) { + groups.push({ + id:self.res_users_ids[u], + content: _t(user_name), + }); + } + } + } + self.timeline.setGroups(groups); + self.timeline.setItems(data); + var mode = !self.mode || self.mode === 'fit'; + var adjust = _.isUndefined(adjust_window) || adjust_window; + self.timeline.setOptions({ + orientation: 'top', + }); + if (mode && adjust) { + self.timeline.fit(); + } + }); + } + }, + + /** + * Transform Odoo event object to timeline event object + * Parameters: + * @param {Array} evt + * @returns r + */ + event_data_transform : function (evt) { + var self = this; + var date_start = new moment(); + var date_stop = null; + var date_delay = evt[this.date_delay] || false, + all_day = this.all_day ? evt[this.all_day] : false; + + if (all_day) { + date_start = time.auto_str_to_date( + evt[this.date_start].split(' ')[0], 'start'); + if (this.no_period) { + date_stop = date_start; + } else { + date_stop = this.date_stop + ? time.auto_str_to_date( + evt[this.date_stop].split(' ')[0], 'stop') : null; + } + } else { + date_start = time.auto_str_to_date(evt[this.date_start]); + date_stop = this.date_stop + ? time.auto_str_to_date(evt[this.date_stop]) : null; + } + + if (!date_stop && date_delay) { + date_stop = + moment(date_start).add(date_delay, 'hours').toDate(); + } + + var group = evt[self.last_group_bys[0]]; + if (group && group instanceof Array) { + group = _.first(group); + } else { + group = -1; + } + _.each(self.colors, function (color) { + if (eval('\'' + evt[color.field] + + '\' ' + color.opt + ' \'' + color.value + '\'')) { + self.color = color.color; + } else if (eval('\'' + evt[color.field][1] + + '\' ' + color.opt + ' \'' + color.value + '\'')) { + self.color = color.color; + } + }); + + var content = _.isUndefined(evt.__name) + ? evt.display_name : evt.__name; + if (this.arch.children.length) { + content = this.render_timeline_item(evt); + } + + var r = { + 'start': date_start, + 'content': content, + 'id': evt.id, + 'group': group, + 'evt': evt, + 'style': 'background-color: ' + self.color + ';', + }; + + /** + * Check if the event is instantaneous, + * if so, display it with a point on the timeline (no 'end') + */ + if (date_stop && !moment(date_start).isSame(date_stop)) { + r.end = date_stop; + } + self.color = null; + return r; + }, + }); +}); diff --git a/fieldservice_web_timeline_view/static/src/js/fsm_gantt_person_filter.js b/fieldservice_web_timeline_view/static/src/js/fsm_gantt_person_filter.js new file mode 100644 index 0000000000..a639b0e1d8 --- /dev/null +++ b/fieldservice_web_timeline_view/static/src/js/fsm_gantt_person_filter.js @@ -0,0 +1,311 @@ +odoo.define('fsm_gantt.person_filter', function (require) { + 'use strict'; + + var TimelineRenderer = require('web_timeline.TimelineRenderer'); + var session = require('web.session'); + var search_filters = require('web.search_filters'); + var core = require('web.core'); + var _t = core._t; + + TimelineRenderer.include({ + + /** + * Init + */ + init : function () { + this._super.apply(this, arguments); + + // Initilaize propositions + this.propositions = []; + }, + + /** + * Do Search + * Parameters: + * @param {Array} domains + * @param {Array} contexts + * @param {Array} group_bys + * @returns Array + */ + do_search : function (domains, contexts, group_bys) { + var self = this; + self.last_domains = domains; + self.last_contexts = contexts; + + // Select the group by + var n_group_bys = []; + if (this.arch.attrs.default_group_by) { + n_group_bys = this.arch.attrs.default_group_by.split(','); + } + if (group_bys.length) { + n_group_bys = group_bys; + } + self.last_group_bys = n_group_bys; + + /* Gather the fields to get + */ + var fields = _.compact(_.map(['date_start', + 'date_delay', 'date_stop', 'progress'], function (key) { + return self.arch.attrs[key] || ''; + })); + fields = _.uniq(fields.concat( + _.pluck(this.colors, 'field').concat(n_group_bys))); + return this._rpc({ + model: this.modelName, + method: 'search_read', + fields: fields, + args: [domains], + kwargs: {context: contexts}, + }).then(function (r) { + return self.on_data_loaded(r, n_group_bys, true); + }); + }, + + /** + * Search data related to user filter + * Parameters: + * @param {Array} domains + * @param {Array} contexts + * @param {Array} group_bys + * @param {Array} user_ids + * @returns Array + */ + do_search_related_user_filter : function (domains, + contexts, group_bys, user_ids) { + var self = this; + + /* Select the group by + */ + var n_group_bys = []; + if (this.arch.attrs.default_group_by) { + n_group_bys = this.arch.attrs.default_group_by.split(','); + } + if (group_bys.length) { + n_group_bys = group_bys; + } + + /* Gather the fields to get + */ + var fields = _.compact(_.map(['date_start', + 'date_delay', 'date_stop', 'progress'], function (key) { + return self.arch.attrs[key] || ''; + })); + fields = _.uniq(fields.concat( + _.pluck(this.colors, 'field').concat(n_group_bys))); + return this._rpc({ + model: this.modelName, + method: 'search_read', + fields: fields, + args: [domains], + kwargs: {context: contexts}, + }).then(function (r) { + return self.on_user_data_loaded(r, n_group_bys, true, user_ids); + }); + }, + + /** + * On user data loaded + * Parameters: + * @param {Array} events + * @param {Array} group_bys + * @param {Object} adjust_window + * @param {Array} user_ids + * @returns Object + */ + on_user_data_loaded : function (events, + group_bys, adjust_window, user_ids) { + var self = this; + var ids = _.pluck(events, 'id'); + return this._rpc({ + model: this.modelName, + method: 'name_get', + args: [ + ids, + ], + context: this.getSession().user_context, + }).then(function (names) { + var nevents = _.map(events, function (event) { + return _.extend({ + __name: _.detect(names, function (name) { + return name[0] === event.id; + })[1], + }, event); + }); + return self.on_user_data_loaded_2(nevents, + group_bys, adjust_window, user_ids); + }); + }, + + /** + * On user data loaded 2 + * Parameters: + * @param {Array} events + * @param {Array} group_bys + * @param {Object} adjust_window + * @param {Array} user_ids + */ + on_user_data_loaded_2 : function (events, + group_bys, adjust_window, user_ids) { + var self = this; + var data = []; + var groups = []; + this.grouped_by = group_bys; + _.each(events, function (event) { + if (event[self.date_start]) { + data.push(self.event_data_transform(event)); + } + }); + + /** + * Get the groups + * Parameters: + * @param {Array} events + * @param {Array} group_bys + * @returns events + */ + var split_groups = function (events, group_bys) { + if (group_bys.length === 0) { + return events; + } + groups = []; + groups.push({id:-1, content: _t('-')}); + _.each(events, function (event) { + var group_name = event[_.first(group_bys)]; + if (group_name) { + var group = _.find(groups, function (group) { + return _.isEqual(group.id, group_name[0]); + }); + if (group === undefined) { + group = {id: group_name[0], content: group_name[1]}; + groups.push(group); + } + } + }); + return groups; + }; + groups = split_groups(events, group_bys); + _.each(user_ids, function (user) { + var group = _.find(groups, function (group) { + return _.isEqual(group.id, user.id); + }); + if (group === undefined) { + group = {id: user.id, + content: user.name}; + groups.push(group); + } + }); + + this.timeline.setGroups(groups); + this.timeline.setItems(data); + var mode = !this.mode || this.mode === 'fit'; + var adjust = _.isUndefined(adjust_window) || adjust_window; + if (mode && adjust) { + this.timeline.fit(); + } + }, + + /** + * Apply/clear User Filter + * @param {Object} clear + */ + apply_clear_user_filter : function (clear) { + var self = this; + if (clear) { + self.user_domains = false; + self.$el.find( + '#user_filer .o_searchview_extended_prop_field').val(''); + self.$el.find( + '#user_filer .o_searchview_extended_prop_field').change(); + self.$el.find( + '#user_filer .o_searchview_extended_prop_field').val( + 'category_id'); + self.$el.find( + '#user_filer .o_searchview_extended_prop_field').change(); + self.do_search( + self.last_domains, self.last_contexts, self.last_group_bys); + } else { + var filters = _.invoke(this.propositions, 'get_filter'); + var domain = filters[0] && filters[0].attrs && + filters[0].attrs.domain ? filters[0].attrs.domain : false; + + /* New method call improved by Sandip on 2018-09-21 */ + if (domain) { + this._rpc({ + model: 'fsm.person', + method: 'search', + args: [domain], + kwargs: {context: session.user_context}, + }).then(function (user_ids) { + var list_user_ids = []; + $.each(user_ids, function (index, value) { + var id = value; + var name = ''; + for (var i in self.res_users[0]) { + if (self.res_users[0][i].id === id) { + name = self.res_users[0][i].name; + } + } + list_user_ids.push({'id':id, 'name':name}); + }); + var ids = user_ids; + ids.push(false); + self.user_domains = ['person_id', 'in', ids]; + var temp_domain = []; + if (self.last_domains) { + temp_domain = _.clone(self.last_domains); + } + temp_domain.push(self.user_domains); + self.do_search_related_user_filter(temp_domain, + self.last_contexts, + self.last_group_bys, + list_user_ids); + }); + } + } + }, + + /** + * On start + * @returns this._super() + */ + start : function () { + var self = this; + + /* Bind User Filter Apply/Clear Click Event */ + this.$el.find('.oe_timeline_button_apply').click( + $.proxy(this.on_apply_clicked, this)); + this.$el.find('.oe_timeline_button_clear').click( + $.proxy(this.on_clear_clicked, this)); + + /* Fetch User Fields And Append To Timeline View. */ + self._rpc({ + model: 'fsm.person', + method: 'fields_get', + }).then(function (fields) { + self.user_filter = true; + var prop = + new search_filters.ExtendedSearchProposition(self, fields); + self.propositions.push(prop); + prop.appendTo(self.$el.find('#user_filer')); + self.$el.find( + '#user_filer .o_searchview_extended_delete_prop').hide(); + self.$el.find('#user_filer .o_or_filter').hide(); + }); + return this._super(); + }, + + /** + * Call apply User Filter + */ + on_apply_clicked : function () { + this.apply_clear_user_filter(false); + }, + + /** + * Call Clear User Filter + */ + on_clear_clicked : function () { + this.apply_clear_user_filter(true); + }, + }); +}); diff --git a/fieldservice_web_timeline_view/static/src/scss/fsm_gantt_person_filter.scss b/fieldservice_web_timeline_view/static/src/scss/fsm_gantt_person_filter.scss new file mode 100644 index 0000000000..64f8a2de7d --- /dev/null +++ b/fieldservice_web_timeline_view/static/src/scss/fsm_gantt_person_filter.scss @@ -0,0 +1,10 @@ +/*User Filter Design*/ +#user_filer{ + &.o_filter_condition select,.o_searchview_extended_prop_value,.o_datepicker,.o_searchview_extended_prop_value input{ + display: inline !important; + width: 150px !important; + } + > li{ + list-style: none; + } +} diff --git a/fieldservice_web_timeline_view/static/src/xml/fsm_gantt_person_filter.xml b/fieldservice_web_timeline_view/static/src/xml/fsm_gantt_person_filter.xml new file mode 100644 index 0000000000..de3ab6466b --- /dev/null +++ b/fieldservice_web_timeline_view/static/src/xml/fsm_gantt_person_filter.xml @@ -0,0 +1,28 @@ + diff --git a/fieldservice_web_timeline_view/views/fsm_order.xml b/fieldservice_web_timeline_view/views/fsm_order.xml new file mode 100644 index 0000000000..f65388b036 --- /dev/null +++ b/fieldservice_web_timeline_view/views/fsm_order.xml @@ -0,0 +1,35 @@ + + +